Introduction：Basic information about CAS 59767-24-7|1-(4-chlorophenyl)-1-phenylethanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-chlorophenyl)-1-phenylethanol |
|---|
| CAS Number | 59767-24-7 | Molecular Weight | 232.705 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 358.2±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H13ClO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 170.5±23.7 °C |
|---|
Names
| Name | 1-(4-chlorophenyl)-1-phenylethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 358.2±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H13ClO |
|---|
| Molecular Weight | 232.705 |
|---|
| Flash Point | 170.5±23.7 °C |
|---|
| Exact Mass | 232.065491 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 3.69 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | MHJLXHJZQCHSIT-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)(c1ccccc1)c1ccc(Cl)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2906299090 |
|---|
Customs
| HS Code | 2906299090 |
|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| Benzenemethanol, 4-chloro-α-methyl-α-phenyl- |
| 1-(4-Chlor-phenyl)-1-phenyl-aethanol |
| A8387 |
| 1-phenyl-1-(p-chlorophenyl)ethanol |
| 1-(4-chloro-phenyl)-1-phenyl-ethanol |
| UNII:6149LO684B |
| 1-Phenyl-1-(4-chlorphenyl)-ethanol |
| 1-(4-Chlorophenyl)-1-phenylethanol |
| 1-(4-Chlorphenyl)-1-phenylethanol |
| Clemastine Impurity 3 |
