Introduction：Basic information about CAS 19046-64-1|dbs, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dbs |
|---|
| CAS Number | 19046-64-1 | Molecular Weight | 358.38500 |
|---|
| Density | 1.272g/cm3 | Boiling Point | 565.2ºC at 760 mmHg |
|---|
| Molecular Formula | C20H22O6 | Melting Point | 224-228ºC |
|---|
| MSDS | / | Flash Point | 295.6ºC |
|---|
Names
| Name | (1,3:2,4) dibenzylidene sorbitol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.272g/cm3 |
|---|
| Boiling Point | 565.2ºC at 760 mmHg |
|---|
| Melting Point | 224-228ºC |
|---|
| Molecular Formula | C20H22O6 |
|---|
| Molecular Weight | 358.38500 |
|---|
| Flash Point | 295.6ºC |
|---|
| Exact Mass | 358.14200 |
|---|
| PSA | 77.38000 |
|---|
| LogP | 1.93660 |
|---|
| Vapour Pressure | 1.31E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | FMZUHGYZWYNSOA-VVBFYGJXSA-N |
|---|
| SMILES | OCC(O)C1OC(c2ccccc2)OC2COC(c3ccccc3)OC21 |
|---|
Synonyms
| DBS |
| 1,3:2,4-di-O-benzylidene-D-sorbitol |
| 1,3:2,4-di-O-benzylidene-D-glucitol |
| 1.3,2.4-dibenzylidene-d-sorbitol |
| 1-O,3-O:2-O,4-O-Dibenzylidene-D-sorbitol |
| 1-O,3-O:2-O,4-O-Dibenzylidene-D-glucitol |
