Introduction：Basic information about CAS 20925-85-3|Pentachlorobenzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pentachlorobenzonitrile |
|---|
| CAS Number | 20925-85-3 | Molecular Weight | 275.347 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 331.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7Cl5N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.8±20.7 °C |
|---|
Names
| Name | 2,3,4,5,6-pentachlorobenzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 331.7±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7Cl5N |
|---|
| Molecular Weight | 275.347 |
|---|
| Flash Point | 142.8±20.7 °C |
|---|
| Exact Mass | 272.847351 |
|---|
| PSA | 23.79000 |
|---|
| LogP | 4.11 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | INICGXSKJYKEIV-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| pentachloro-benzonitrile |
| Benzonitrile, 2,3,4,5,6-pentachloro- |
| HMS547C17 |
| Benzonitrile,pentachloro |
| 2,3',4,4',5-PENTACB |
| Pentachlorobenzonitrile |
| 2,3,4,5-Pentachlor-benzocyanid |
| Pentachlorbenzolcarbonitril |
| Pentachlor-benzonitril |
| MFCD00173666 |
