Introduction:Basic information about CAS 1115-20-4|neopentyl glycol mono(hydroxypivalate), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | neopentyl glycol mono(hydroxypivalate) |
|---|
| CAS Number | 1115-20-4 | Molecular Weight | 204.26300 |
|---|
| Density | 1.01 | Boiling Point | 292°C |
|---|
| Molecular Formula | C10H20O4 | Melting Point | 46-50°C |
|---|
| MSDS | / | Flash Point | 292°C |
|---|
Names
| Name | neopentyl glycol mono(hydroxypivalate) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.01 |
|---|
| Boiling Point | 292°C |
|---|
| Melting Point | 46-50°C |
|---|
| Molecular Formula | C10H20O4 |
|---|
| Molecular Weight | 204.26300 |
|---|
| Flash Point | 292°C |
|---|
| Exact Mass | 204.13600 |
|---|
| PSA | 66.76000 |
|---|
| LogP | 0.56660 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.474 |
|---|
| InChIKey | SZCWBURCISJFEZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(CO)COC(=O)C(C)(C)CO |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2918199090 |
|---|
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Neopentyl Glycol Mono(hydroxypivalate) |
| 2,2-Dimethyl-1,3-propanediol Mono(hydroxypivalate) |
| (3-hydroxy-2,2-dimethylpropyl) 3-hydroxy-2,2-dimethylpropanoate |
| MFCD00059597 |
| EINECS 214-222-2 |
| 3-Hydroxy-2,2-dimethylpropyl 3-Hydroxy-2,2-dimethylpropionate |
| Hydroxypivalic Acid Neopentyl Glycol Ester |