Introduction:Basic information about CAS 30616-38-7|4-amino-2-benzothiazol-2-yl-phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-amino-2-benzothiazol-2-yl-phenol |
|---|
| CAS Number | 30616-38-7 | Molecular Weight | 242.29600 |
|---|
| Density | 1.408g/cm3 | Boiling Point | 349.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H10N2OS | Melting Point | 190-190.5℃ |
|---|
| MSDS | ChineseUSA | Flash Point | 165.1ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-amino-2-benzothiazol-2-yl-phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.408g/cm3 |
|---|
| Boiling Point | 349.4ºC at 760mmHg |
|---|
| Melting Point | 190-190.5℃ |
|---|
| Molecular Formula | C13H10N2OS |
|---|
| Molecular Weight | 242.29600 |
|---|
| Flash Point | 165.1ºC |
|---|
| Exact Mass | 242.05100 |
|---|
| PSA | 87.38000 |
|---|
| LogP | 3.83230 |
|---|
| Index of Refraction | 1.733 |
|---|
| InChIKey | UBRCBHVOYDSGKZ-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccc(O)c(-c2nc3ccccc3s2)c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 22-36/37/38 |
|---|
| Safety Phrases | 26-36/37 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2934200090 |
|---|
Customs
| HS Code | 2934200090 |
|---|
| Summary | 2934200090. other compounds containing in the structure a benzothiazole ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4-Amino-2-(2-benzothiazolyl)phenol |
| 4-amino-2-(2-benzothiazolyl)phenol |
| 4-amino-2-(benzo[d]thiazol-2-yl)phenol |
| 2-(5-amino-2-hydroxyphenyl)benzothiazole |
| 2-(2'-hydroxy-5'-aminophenyl)benzothiazole |
| 4-amino-2-(benzothiazol-2-yl)-phenol |
| 4-AMINO-2-(1,3-BENZOTHIAZOL-2-YL)PHENOL |