Introduction:Basic information about CAS 879619-96-2|N-[(2,5-dimethoxyphenyl)methyl]cyclohexanamine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[(2,5-dimethoxyphenyl)methyl]cyclohexanamine |
|---|
| CAS Number | 879619-96-2 | Molecular Weight | 249.34900 |
|---|
| Density | 1.04g/cm3 | Boiling Point | 365.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.2ºC |
|---|
Names
| Name | N-[(2,5-dimethoxyphenyl)methyl]cyclohexanamine |
|---|
Chemical & Physical Properties
| Density | 1.04g/cm3 |
|---|
| Boiling Point | 365.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H23NO2 |
|---|
| Molecular Weight | 249.34900 |
|---|
| Flash Point | 154.2ºC |
|---|
| Exact Mass | 249.17300 |
|---|
| PSA | 30.49000 |
|---|
| LogP | 3.51700 |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | QOLDMSMUZHEJEG-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(OC)c(CNC2CCCCC2)c1 |
|---|