Introduction：Basic information about CAS 99099-78-2|[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl] 4-methylbenzenesulfonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl] 4-methylbenzenesulfonate |
|---|
| CAS Number | 99099-78-2 | Molecular Weight | 419.45200 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 708.2ºC at 760mmHg |
|---|
| Molecular Formula | C19H21N3O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 382.1ºC |
|---|
Names
| Name | [2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl] 4-methylbenzenesulfonate |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 708.2ºC at 760mmHg |
|---|
| Molecular Formula | C19H21N3O6S |
|---|
| Molecular Weight | 419.45200 |
|---|
| Flash Point | 382.1ºC |
|---|
| Exact Mass | 419.11500 |
|---|
| PSA | 143.15000 |
|---|
| LogP | 1.81720 |
|---|
| Index of Refraction | 1.65 |
|---|
| InChIKey | WHXCEDUFWVSHQA-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)C(O)C(O)c2cnn(-c3ccccc3)n2)cc1 |
|---|
