Introduction：Basic information about CAS 871798-95-7|5,6-DI(FURAN-2-YL)-3-PHENYL-[2,2']BIPYRIDINYL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-DI(FURAN-2-YL)-3-PHENYL-[2,2']BIPYRIDINYL |
|---|
| CAS Number | 871798-95-7 | Molecular Weight | 364.39600 |
|---|
| Density | 1.204g/cm3 | Boiling Point | 464.382ºC at 760 mmHg |
|---|
| Molecular Formula | C24H16N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 110.963ºC |
|---|
Names
| Name | 2,3-bis(furan-2-yl)-5-phenyl-6-pyridin-2-ylpyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.204g/cm3 |
|---|
| Boiling Point | 464.382ºC at 760 mmHg |
|---|
| Molecular Formula | C24H16N2O2 |
|---|
| Molecular Weight | 364.39600 |
|---|
| Flash Point | 110.963ºC |
|---|
| Exact Mass | 364.12100 |
|---|
| PSA | 52.06000 |
|---|
| LogP | 6.33060 |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | GJTKXPRFIGLAAA-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(-c2cc(-c3ccco3)c(-c3ccco3)nc2-c2ccccn2)cc1 |
|---|
Synonyms
| 2,2'-Bipyridine,5,6-di-2-furanyl-3-phenyl |
