Introduction：Basic information about CAS 146924-93-8|(1-benzoyl-2-oxo-4-phenylazetidin-3-yl) acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1-benzoyl-2-oxo-4-phenylazetidin-3-yl) acetate |
|---|
| CAS Number | 146924-93-8 | Molecular Weight | 309.31600 |
|---|
| Density | 1.319g/cm3 | Boiling Point | 455.28ºC at 760 mmHg |
|---|
| Molecular Formula | C18H15NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.145ºC |
|---|
Names
| Name | (1-benzoyl-2-oxo-4-phenylazetidin-3-yl) acetate |
|---|
Chemical & Physical Properties
| Density | 1.319g/cm3 |
|---|
| Boiling Point | 455.28ºC at 760 mmHg |
|---|
| Molecular Formula | C18H15NO4 |
|---|
| Molecular Weight | 309.31600 |
|---|
| Flash Point | 229.145ºC |
|---|
| Exact Mass | 309.10000 |
|---|
| PSA | 63.68000 |
|---|
| LogP | 2.27990 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | IYBNNNDZBNQFRB-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)OC1C(=O)N(C(=O)c2ccccc2)C1c1ccccc1 |
|---|
