Introduction:Basic information about CAS 1975-51-5|2-Methyl-4-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-4-nitrobenzoic acid |
|---|
| CAS Number | 1975-51-5 | Molecular Weight | 181.145 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 369.3±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H7NO4 | Melting Point | 150-154ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 167.6±13.0 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-Methyl-4-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 369.3±30.0 °C at 760 mmHg |
|---|
| Melting Point | 150-154ºC |
|---|
| Molecular Formula | C8H7NO4 |
|---|
| Molecular Weight | 181.145 |
|---|
| Flash Point | 167.6±13.0 °C |
|---|
| Exact Mass | 181.037506 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.35 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | XXXOBNJIIZQSPT-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])ccc1C(=O)O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H317 |
|---|
| Precautionary Statements | P280 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R22;R43 |
|---|
| Safety Phrases | S37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| EINECS 217-828-5 |
| MFCD00210697 |
| 2-methyl-4-nitrobenzic acid |
| 2-Methyl-4-nitro-benzoesaeure |
| 2-Methyl-4-nitrobenzoic acid |
| 4-Nitro-o-toluylsaeure |
| 2-METHYL-4-NITROBENZOIC ACID 97 |
| Benzoic acid, 2-methyl-4-nitro- |
| 2-Methyl-4-nitrobenzoicacid |
| 4-Nitro-o-toluic acid |
| 4-Nitro-2-methylbenzoic acid |
| WNR C1 DVQ |