Introduction：Basic information about CAS 68345-22-2|phenyl acetaldehyde diisobutyl acetal, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | phenyl acetaldehyde diisobutyl acetal |
|---|
| CAS Number | 68345-22-2 | Molecular Weight | 250.37600 |
|---|
| Density | 0.933g/cm3 | Boiling Point | 300.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H26O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 93.4ºC |
|---|
Names
| Name | 2,2-bis(2-methylpropoxy)ethylbenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.933g/cm3 |
|---|
| Boiling Point | 300.9ºC at 760 mmHg |
|---|
| Molecular Formula | C16H26O2 |
|---|
| Molecular Weight | 250.37600 |
|---|
| Flash Point | 93.4ºC |
|---|
| Exact Mass | 250.19300 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 3.90040 |
|---|
| Index of Refraction | 1.48 |
|---|
| InChIKey | IORFKGJOBOCHPX-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)COC(Cc1ccccc1)OCC(C)C |
|---|
Synonyms
| EINECS 269-851-5 |
| (2,2-diisobutoxyethyl)benzene |
| Phenylacetaldehyde diisobutyl acetal |
| 1,1-Diisobutoxy-2-phenylethane |
| Benzene,(2,2-bis(2-methylpropoxy)ethyl) |
| (2,2-Bis(2-methylpropoxy)ethyl)benzene |
| FEMA No. 3384 |
