Introduction：Basic information about CAS 15687-33-9|2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl 2-hydroxy-2,2-diphenylacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl 2-hydroxy-2,2-diphenylacetate |
|---|
| CAS Number | 15687-33-9 | Molecular Weight | 393.51900 |
|---|
| Density | 1.13g/cm3 | Boiling Point | 484.8ºC at 760 mmHg |
|---|
| Molecular Formula | C25H31NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247ºC |
|---|
Names
| Name | 2-(1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-3-yl)ethyl 2-hydroxy-2,2-diphenylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.13g/cm3 |
|---|
| Boiling Point | 484.8ºC at 760 mmHg |
|---|
| Molecular Formula | C25H31NO3 |
|---|
| Molecular Weight | 393.51900 |
|---|
| Flash Point | 247ºC |
|---|
| Exact Mass | 393.23000 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 3.91410 |
|---|
| Vapour Pressure | 3.27E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.566 |
|---|
| InChIKey | CCZXHOQYLPLQNP-UHFFFAOYSA-N |
|---|
| SMILES | CN1CC(CCOC(=O)C(O)(c2ccccc2)c2ccccc2)C2CCCCC21 |
|---|
Synonyms
| METHINDIZATE |
| Metindizatum |
| Metindizate |
| 2-(N-Methyl-octahydroindol-3-yl)-ethyl-benzilat |
| 2-(1-Methyl-3-perhydroindolyl)ethyl benzilat |
| Metindizato |
