Introduction：Basic information about CAS 95374-52-0|Prideperone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Prideperone |
|---|
| CAS Number | 95374-52-0 | Molecular Weight | 409.45300 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 606.2ºC at 760 mmHg |
|---|
| Molecular Formula | C23H24FN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 320.4ºC |
|---|
Names
| Name | 5-cyano-N-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-2-methoxybenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 606.2ºC at 760 mmHg |
|---|
| Molecular Formula | C23H24FN3O3 |
|---|
| Molecular Weight | 409.45300 |
|---|
| Flash Point | 320.4ºC |
|---|
| Exact Mass | 409.18000 |
|---|
| PSA | 82.43000 |
|---|
| LogP | 3.35948 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | XMRWAAOHXNIGHP-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C#N)cc1C(=O)NCCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
|---|
Synonyms
| Prideperone |
| UNII-78W508SA0Q |
| 5-Cyano-N-(2-(4-(p-fluorobenzoyl)piperidino)ethyl)-o-anisamide |
| Prideperone [INN] |
