Introduction：Basic information about CAS 122955-18-4|Sibopirdine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sibopirdine |
|---|
| CAS Number | 122955-18-4 | Molecular Weight | 350.41600 |
|---|
| Density | 1.268g/cm3 | Boiling Point | 591.2ºC at 760 mmHg |
|---|
| Molecular Formula | C23H18N4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 265.4ºC |
|---|
Names
| Name | Sibopirdine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.268g/cm3 |
|---|
| Boiling Point | 591.2ºC at 760 mmHg |
|---|
| Molecular Formula | C23H18N4 |
|---|
| Molecular Weight | 350.41600 |
|---|
| Flash Point | 265.4ºC |
|---|
| Exact Mass | 350.15300 |
|---|
| PSA | 51.56000 |
|---|
| LogP | 4.01850 |
|---|
| Vapour Pressure | 2.51E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | FJYRSJDIZKTXKB-UHFFFAOYSA-N |
|---|
| SMILES | c1cnc2c(c1)C(Cc1ccncc1)(Cc1ccncc1)c1cccnc1-2 |
|---|
Synonyms
