CAS 85-46-1|1-Naphthalenesulfonyl chloride
Introduction:Basic information about CAS 85-46-1|1-Naphthalenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Naphthalenesulfonyl chloride | ||
|---|---|---|---|
| CAS Number | 85-46-1 | Molecular Weight | 226.67900 |
| Density | 1.414 g/cm3 | Boiling Point | 194-195 °C13 mm Hg(lit.) |
| Molecular Formula | C10H7ClO2S | Melting Point | 64-67 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 194-195°C/13mm |
| Symbol | GHS05 | Signal Word | Danger |
Names
| Name | 1-Naphthalenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.414 g/cm3 |
|---|---|
| Boiling Point | 194-195 °C13 mm Hg(lit.) |
| Melting Point | 64-67 °C(lit.) |
| Molecular Formula | C10H7ClO2S |
| Molecular Weight | 226.67900 |
| Flash Point | 194-195°C/13mm |
| Exact Mass | 225.98600 |
| PSA | 42.52000 |
| LogP | 3.84810 |
| Index of Refraction | 1.643 |
| InChIKey | DASJFYAPNPUBGG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cccc2ccccc12 |
| Water Solubility | insoluble |
Safety Information
| Symbol | GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
Customs
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
Articles3
More Articles| 1-Sulfonylindazoles as potent and selective 5-HT6 ligands. Bioorg. Med. Chem. Lett. 19(9) , 2413-5, (2009) As part of our continuing efforts to identify therapeutics for CNS diseases, such as schizophrenia and Alzheimer's disease (AD), we have been focused on the 5-HT(6) receptor in an attempt to identify ... | |
| Aryl and arylmethyl C-glycosides through desulfitative stille and carbonylative stille cross-coupling of tinglycals and sulfonyl chlorides. Dubbaka SR, et al. Synlett 2004(07) , 1235-38, (2004) | |
| A simple method for the synthesis of O2, 5′-cyclodeoxyuridine. Tang SS and Roth JS. Tetrahedron Lett. 9(17) , 2123-25, (1968) |
Synonyms
| NAPHTHALENE-1-SULFONYL CHLORIDE |
| EINECS 201-609-6 |
| NAPHTHOSULFOCHLORIDE |
| 1-NAPHTHALENESULPHONYL CHLORIDE |
| Naphthalene sulfonyl chloride |
| 1-Naphthylsulfonyl chloride |
| 1-naphthalene sulfonyl chloride |
| NAPHTHALENE-1-SULPHONYL CHLORIDE |
| 1-Chlorosulfonylnaphthalene |
| 1-NAPTHALENESULFONIC CHLORIDE |
| MFCD00003984 |
| 1-naphthalenesulfonic acid chloride |
