Introduction:Basic information about CAS 5317-94-2|N-(4-acetylphenyl)-4-methylbenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(4-acetylphenyl)-4-methylbenzenesulfonamide |
|---|
| CAS Number | 5317-94-2 | Molecular Weight | 289.35000 |
|---|
| Density | 1.278g/cm3 | Boiling Point | 462.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H15NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.3ºC |
|---|
Names
| Name | N-(4-acetylphenyl)-4-methylbenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.278g/cm3 |
|---|
| Boiling Point | 462.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H15NO3S |
|---|
| Molecular Weight | 289.35000 |
|---|
| Flash Point | 233.3ºC |
|---|
| Exact Mass | 289.07700 |
|---|
| PSA | 71.62000 |
|---|
| LogP | 4.15220 |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | FPXRFFCKWPPNEV-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| n-(4-acetyl-phenyl)-4-methyl-benzenesulfonamide |
| 4-<N-(p-tolylsulfonyl)amino>acetophenone |
| p-(toluenesulfonamido)acetophenone |
| 4'-(4-toluenesulfonamido)acetophenone |
| 4-(p-toluenesulfonylamino)acetophenone |
| F1498-0032 |
| p-(N-p-tolylsulphonylamino)acetophenone |
| N-(4-acetylphenyl)-4-Methylbenzensulfonamide |