Introduction:Basic information about CAS 59724-85-5|{(carboxymethyl)[(4-methylphenyl)sulfonyl]amino}acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | {(carboxymethyl)[(4-methylphenyl)sulfonyl]amino}acetic acid |
|---|
| CAS Number | 59724-85-5 | Molecular Weight | 287.28900 |
|---|
| Density | 1.484g/cm3 | Boiling Point | 545.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13NO6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.7ºC |
|---|
Names
| Name | {(carboxymethyl)[(4-methylphenyl)sulfonyl]amino}acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.484g/cm3 |
|---|
| Boiling Point | 545.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H13NO6S |
|---|
| Molecular Weight | 287.28900 |
|---|
| Flash Point | 283.7ºC |
|---|
| Exact Mass | 287.04600 |
|---|
| PSA | 120.36000 |
|---|
| LogP | 1.23570 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | SZXDVECDHDWSAU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)O)CC(=O)O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2935009090 |
|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|---|
Synonyms
| (toluene-4-sulfonylimino)-di-acetic acid |
| N-Tosyl-dithiocarbamidsaeure-methylester |
| Carbamodithioic acid,[(4-methylphenyl)sulfonyl]-,methyl ester |
| N-Tosyliminodiacetic Acid |
| methyl 4-methylphenylsulfonyldithiocarbamate |
| N-p-toluenesulfonyl-iminodiacetic acid |
| N-Tosyl-iminodiessigsaeure |
| (4-methylphenyl)sulfonylcarbamodithioic acid methyl ester |
| (toluene-4-sulfonyl)-dithiocarbamic acid methyl ester |
| N-(Methylmercapto-thiocarbonyl)-p-toluolsulfonamid |
| (Toluol-4-sulfonylimino)-di-essigsaeure |