Introduction:Basic information about CAS 20170-32-5|3-(3,5-Di-tert-butyl-4-hydroxyphenyl)propionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(3,5-Di-tert-butyl-4-hydroxyphenyl)propionic acid |
|---|
| CAS Number | 20170-32-5 | Molecular Weight | 278.38700 |
|---|
| Density | 1.049 g/cm3 | Boiling Point | 364.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H26O3 | Melting Point | 172-174°C |
|---|
| MSDS | / | Flash Point | 188.3ºC |
|---|
Names
| Name | 3,5-Di-tert-butyl-4-hydroxyphenylpropionic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.049 g/cm3 |
|---|
| Boiling Point | 364.3ºC at 760 mmHg |
|---|
| Melting Point | 172-174°C |
|---|
| Molecular Formula | C17H26O3 |
|---|
| Molecular Weight | 278.38700 |
|---|
| Flash Point | 188.3ºC |
|---|
| Exact Mass | 278.18800 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 4.00440 |
|---|
| Vapour Pressure | 6.03E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.52 |
|---|
| InChIKey | WPMYUUITDBHVQZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(CCC(=O)O)cc(C(C)(C)C)c1O |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2918290000 |
|---|
Customs
| HS Code | 2918290000 |
|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3,5-Di-tert-butyl-4-hydroxybenzenepropionic acid |
| 3,5-Di-tert-Butyl-4-hydroxyhydrocinnamic acid |
| EINECS 243-556-1 |
| MFCD00017519 |
| Dibutylhydroxyphenylpropionicacid |
| 4-HYDROXY-3,5-DI-TERT-BUTYLPHENYLPROPIONIC ACID |
| 3-(3,5-Di-Tert-butyl-4-hydroxyphenyl)propanoic acid |
| Fenozan acid |