Introduction：Basic information about CAS 304680-35-1|1-Hexyl-3-methylimidazolium Hexafluorophosphate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Hexyl-3-methylimidazolium Hexafluorophosphate |
|---|
| CAS Number | 304680-35-1 | Molecular Weight | 312.23500 |
|---|
| Density | 1.3045 | Boiling Point | / |
|---|
| Molecular Formula | C10H19F6N2P | Melting Point | -73.5 °C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-hexyl-3-methylimidazol-3-ium,hexafluorophosphate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3045 |
|---|
| Melting Point | -73.5 °C |
|---|
| Molecular Formula | C10H19F6N2P |
|---|
| Molecular Weight | 312.23500 |
|---|
| Exact Mass | 312.11900 |
|---|
| PSA | 22.40000 |
|---|
| LogP | 5.27530 |
|---|
| Index of Refraction | n20/D 1.419 |
|---|
| InChIKey | YPWSSSRXUOQNMQ-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCn1cc[n+](C)c1.F[P-](F)(F)(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 1-Hexyl-3-methylimidazolium Hexafluorophosphate |
| MFCD03093296 |
| 3-Hexyl-1-methyl-1H-imidazol-3-ium hexafluorophosphate |
| 1-Hexyl-3-methyl-1H-imidazol-3-ium hexafluorophosphate |
