Introduction：Basic information about CAS 1584-62-9|2-bromo-4'-chloro-2'-(o-fluorobenzoyl)acetanilide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-bromo-4'-chloro-2'-(o-fluorobenzoyl)acetanilide |
|---|
| CAS Number | 1584-62-9 | Molecular Weight | 370.60100 |
|---|
| Density | 1.611g/cm3 | Boiling Point | 575.2ºC at 760mmHg |
|---|
| Molecular Formula | C15H10BrClFNO2 | Melting Point | 132-133ºC |
|---|
| MSDS | / | Flash Point | 301.7ºC |
|---|
Names
| Name | 2-bromo-N-[4-chloro-2-(2-fluorobenzoyl)phenyl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.611g/cm3 |
|---|
| Boiling Point | 575.2ºC at 760mmHg |
|---|
| Melting Point | 132-133ºC |
|---|
| Molecular Formula | C15H10BrClFNO2 |
|---|
| Molecular Weight | 370.60100 |
|---|
| Flash Point | 301.7ºC |
|---|
| Exact Mass | 368.95700 |
|---|
| PSA | 46.17000 |
|---|
| LogP | 4.11650 |
|---|
| Vapour Pressure | 3.1E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.64 |
|---|
| InChIKey | WUZSFIKFFXBHMB-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CBr)Nc1ccc(Cl)cc1C(=O)c1ccccc1F |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Bromacetylamino-5-chlor-2'-fluor-benzophenon |
| 2-Bromo-N-(4-chloro-2-(2-fluorobenzoyl)phenyl)acetamide |
| 2-bromo-4'-chloro-2'-(o-fluorobenzoyl)acetanilide |
| 2-Bromo-4'-chloro-2'-(2-fluorobenzoyl)acetanilide |
| 2-(2-bromo-acetylamino)-5-chloro-2'-fluoro-benzophenone |
| 2-Bromacetamido-5-chlor-2'-fluorbenzophenon |
| N-[2-(2-Fluorophenyl)-4-chlorophenyl-2-bromoacetamide |
| EINECS 216-437-7 |
| 2-Bromacetamino-5-chlor-2'-fluor-benzophenon |
