Introduction:Basic information about CAS 19340-26-2|2,3,5,6-Tetrachloroisonicotinic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,5,6-Tetrachloroisonicotinic acid |
|---|
| CAS Number | 19340-26-2 | Molecular Weight | 260.890 |
|---|
| Density | 1.8±0.1 g/cm3 | Boiling Point | 426.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6HCl4NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.9±27.3 °C |
|---|
Names
| Name | 2,3,5,6-Tetrachloropyridine-4-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.8±0.1 g/cm3 |
|---|
| Boiling Point | 426.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6HCl4NO2 |
|---|
| Molecular Weight | 260.890 |
|---|
| Flash Point | 211.9±27.3 °C |
|---|
| Exact Mass | 258.876129 |
|---|
| PSA | 50.19000 |
|---|
| LogP | 3.12 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.630 |
|---|
| InChIKey | FNZSPKURESXAII-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1c(Cl)c(Cl)nc(Cl)c1Cl |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| tetrachloroisonicotic acid |
| tetrachloro-isonicotinic acid |
| 4-Pyridinecarboxylicacid,2,3,5,6-tetrachloro |
| 2,3,5,6-Tetrachloroisonicotinic acid |
| 4-Pyridinecarboxylic acid, 2,3,5,6-tetrachloro- |
| 2,3,5,6-Tetrachlor-pyridin-4-carbonsaeure |
| 2,3,5,6-Tetrachlor-pyridin-carbonsaeure-(4) |
| 2,3,5,6-Tetrachlorisonicotinsaeure |
| Tetrachlor-isonicotinsaeure |
| Isonicotinicacid,tetrachloro-(8CI) |