Introduction：Basic information about CAS 14848-01-2|4-azidobenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-azidobenzoyl chloride |
|---|
| CAS Number | 14848-01-2 | Molecular Weight | 181.57900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C7H4ClN3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-azidobenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C7H4ClN3O |
|---|
| Molecular Weight | 181.57900 |
|---|
| Exact Mass | 181.00400 |
|---|
| PSA | 66.82000 |
|---|
| LogP | 2.46016 |
|---|
| InChIKey | XXKYTTAVNYTVFC-UHFFFAOYSA-N |
|---|
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)Cl)cc1 |
|---|
Safety Information
Customs
| HS Code | 2929909090 |
|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-Azido-benzoyl chloride |
| EINECS 238-910-7 |
| 4-azido-benzoic acid chloride |
| 4-Azidobenzoylchlorid |
| Benzoyl chloride,4-azido |
| p-azidobenzoyl chloride |
| p-azidobenzoic acid chloride |
