Introduction:Basic information about CAS 51127-21-0|N-(5-Methyl-4-oxo-1,3-dioxan-5-yl)benzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(5-Methyl-4-oxo-1,3-dioxan-5-yl)benzamide |
|---|
| CAS Number | 51127-21-0 | Molecular Weight | 235.236 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 494.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H13NO4 | Melting Point | 154-159ºC |
|---|
| MSDS | / | Flash Point | 253.0±28.7 °C |
|---|
Names
| Name | DL-5-Benzoylamino-5 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 494.8±45.0 °C at 760 mmHg |
|---|
| Melting Point | 154-159ºC |
|---|
| Molecular Formula | C12H13NO4 |
|---|
| Molecular Weight | 235.236 |
|---|
| Flash Point | 253.0±28.7 °C |
|---|
| Exact Mass | 235.084457 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 0.02 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.562 |
|---|
| InChIKey | CBPVXQIYADPGSJ-LBPRGKRZSA-N |
|---|
| SMILES | CC1(NC(=O)c2ccccc2)COCOC1=O |
|---|
Synonyms
| Benzamide, N-(5-methyl-4-oxo-1,3-dioxan-5-yl)- |
| dl-5-benzoylamino-5-methyl-4-oxo-1,3-dioxane,97 |
| N-(5-Methyl-4-oxo-1,3-dioxan-5-yl)benzamide |
| MFCD01863310 |