Introduction:Basic information about CAS 111060-54-9|1-Butanol,2-[bis(phenylmethyl)amino]-3-methyl-, (2S)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Butanol,2-[bis(phenylmethyl)amino]-3-methyl-, (2S)- |
|---|
| CAS Number | 111060-54-9 | Molecular Weight | 283.40800 |
|---|
| Density | 1.0088 g/mL at 25ºC | Boiling Point | 397.414ºC at 760 mmHg |
|---|
| Molecular Formula | C19H25NO | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 140 °F |
|---|
| Symbol | GHS02, GHS07 | Signal Word | Warning |
|---|
Names
| Name | (s)-2-(dibenzylamino)-3-methyl-1-butanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0088 g/mL at 25ºC |
|---|
| Boiling Point | 397.414ºC at 760 mmHg |
|---|
| Molecular Formula | C19H25NO |
|---|
| Molecular Weight | 283.40800 |
|---|
| Flash Point | 140 °F |
|---|
| Exact Mass | 283.19400 |
|---|
| PSA | 23.47000 |
|---|
| LogP | 3.70570 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | n20/D 1.5459 |
|---|
| InChIKey | ZWLAXLXECFRUPM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(CO)N(Cc1ccccc1)Cc1ccccc1 |
|---|
Safety Information
| Symbol | GHS02, GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H226-H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | UN 1993 3/PG 3 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| dibenzyl valinol |
| (S)-2-N-(tert-butoxycarbonyl)amino-2-methyl-3-hydroxypropanoic acid methyl ester |
| N-Boc-2-Methyl-D-serine Methyl ester |
| 2-(N,N-dibenzyl)amino-3-methyl-1-butanol |
| N,N-dibenzyl leucinol |
| (S)-N-tert-butoxycarbonyl-2-methylserine methyl ester |
| methyl (S)-2-(tert-butoxycarbonylamino)-3-hydroxy-2-methylpropanoate |
| N,N-dibenzylvalinol |
| (S)-2-(N,N-dibenzylamino)-3-methyl-1-butanol |
| (S)-Boc-2-methylserine methyl ester |
| N-BOC-A-METHYL-D-SERINE METHYL ESTER |
| (S)-2-(tert-ButoxycarbonylaMino)-3-hydroxy-2-Methylpropanoic acid Methyl ester |
| (S)-2-(dibenzylamino)-3-methylbutan-1-ol |