Introduction：Basic information about CAS 868755-57-1|2,4-diphenyl-1,3-thiazole-5-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4-diphenyl-1,3-thiazole-5-sulfonyl chloride |
|---|
| CAS Number | 868755-57-1 | Molecular Weight | 335.82800 |
|---|
| Density | 1.403g/cm3 | Boiling Point | 524.5ºC at 760 mmHg |
|---|
| Molecular Formula | C15H10ClNO2S2 | Melting Point | 173ºC |
|---|
| MSDS | / | Flash Point | 271ºC |
|---|
Names
| Name | 2,4-diphenyl-1,3-thiazole-5-sulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.403g/cm3 |
|---|
| Boiling Point | 524.5ºC at 760 mmHg |
|---|
| Melting Point | 173ºC |
|---|
| Molecular Formula | C15H10ClNO2S2 |
|---|
| Molecular Weight | 335.82800 |
|---|
| Flash Point | 271ºC |
|---|
| Exact Mass | 334.98400 |
|---|
| PSA | 83.65000 |
|---|
| LogP | 5.48540 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | AWNJOBYLGNWNCQ-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1sc(-c2ccccc2)nc1-c1ccccc1 |
|---|
Safety Information
| Risk Phrases | 14-29-34 |
|---|
| Safety Phrases | 8-22-26-30-36/37/39-45 |
|---|
| RIDADR | UN 3261 |
|---|
Synonyms
| 5-Thiazolesulfonylchloride,2,4-diphenyl |
| Y4399 |
| 2,4-DIBROMOIODOBENZENE |
| diphenyl-1,3-thiazole-5-sulfonyl chloride |
