Introduction：Basic information about CAS 4259-43-2|1,1,1-trichloropentafluoropropane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,1-trichloropentafluoropropane |
|---|
| CAS Number | 4259-43-2 | Molecular Weight | 237.38300 |
|---|
| Density | 1.646 g/cm3 | Boiling Point | 70-71ºC |
|---|
| Molecular Formula | C3Cl3F5 | Melting Point | -80ºC |
|---|
| MSDS | / | Flash Point | 3ºC |
|---|
Names
| Name | 1,1,1-trichloropentafluoropropane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.646 g/cm3 |
|---|
| Boiling Point | 70-71ºC |
|---|
| Melting Point | -80ºC |
|---|
| Molecular Formula | C3Cl3F5 |
|---|
| Molecular Weight | 237.38300 |
|---|
| Flash Point | 3ºC |
|---|
| Exact Mass | 235.89900 |
|---|
| LogP | 3.55420 |
|---|
| Index of Refraction | 1.3527 |
|---|
| InChIKey | HJRXHKBZNQULJQ-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(Cl)(Cl)Cl |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2903772024 |
|---|
Customs
| HS Code | 2903772024 |
|---|
| Summary | 2903772024 1,2,2-trichloro-1,1,3,3,3-pentafluoropropane。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。Lowest tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 1,1,1-trichloro-pentafluoro-propane |
| 2,2,3,3,3-pentafluoro-1,1,1-trichloropropane |
| R-215 |
| cfc215 |
| freon215 |
| 1,1,1-Trichlor-pentafluor-propan |
| 1,1,1-trichloropentafluoro-propan |
| 1,1,1-trichloro-2,2,3,3,3-pentafluoropropane |
| trichloropentafluoro-propane |
