Introduction：Basic information about CAS 590376-39-9|ART-CHEM-BB B018027, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ART-CHEM-BB B018027 |
|---|
| CAS Number | 590376-39-9 | Molecular Weight | 245.34300 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 348.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15N3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 164.4ºC |
|---|
Names
| Name | 3-(2-phenylethyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 348.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H15N3S |
|---|
| Molecular Weight | 245.34300 |
|---|
| Flash Point | 164.4ºC |
|---|
| Exact Mass | 245.09900 |
|---|
| PSA | 69.51000 |
|---|
| LogP | 2.53800 |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | SUVDKGDAFNEOAN-UHFFFAOYSA-N |
|---|
| SMILES | C=CCn1c(CCc2ccccc2)n[nH]c1=S |
|---|
Safety Information
