Introduction:Basic information about CAS 38985-79-4|2-acetamido-5-bromobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-acetamido-5-bromobenzoic acid |
|---|
| CAS Number | 38985-79-4 | Molecular Weight | 258.06900 |
|---|
| Density | 1.706g/cm3 | Boiling Point | 457.8ºC at 760mmHg |
|---|
| Molecular Formula | C9H8BrNO3 | Melting Point | 218ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 230.7ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-acetamido-5-bromobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.706g/cm3 |
|---|
| Boiling Point | 457.8ºC at 760mmHg |
|---|
| Melting Point | 218ºC |
|---|
| Molecular Formula | C9H8BrNO3 |
|---|
| Molecular Weight | 258.06900 |
|---|
| Flash Point | 230.7ºC |
|---|
| Exact Mass | 256.96900 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.17870 |
|---|
| Appearance of Characters | Crystals or Crystalline Powder | Pale brown |
|---|
| Index of Refraction | 1.6200 (estimate) |
|---|
| InChIKey | QVABAFHRLMDDLM-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Nc1ccc(Br)cc1C(=O)O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302-H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 22 |
|---|
| Safety Phrases | S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-acetylamino-5-bromo-benzoic acid |
| 5-bromo-N-acetylanthranilic acid |
| 2-Acetylamino-5-brom-benzoesaeure |
| MFCD00040904 |
| N-Acetyl-5-brom-anthranilsaeure |
| 2-Acetamido-5-bromobenzoic acid |
| N-ACETYL-5-BROMOANTHRANILIC ACID |
| 5-Brom-2-acetamino-benzoesaeure |