Introduction:Basic information about CAS 261704-15-8|2-(1,3-dithiolan-2-yl)-4-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(1,3-dithiolan-2-yl)-4-nitrophenol |
|---|
| CAS Number | 261704-15-8 | Molecular Weight | 243.30300 |
|---|
| Density | 1.5g/cm3 | Boiling Point | 379.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9NO3S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.1ºC |
|---|
Names
| Name | 2-(1,3-dithiolan-2-yl)-4-nitrophenol |
|---|
Chemical & Physical Properties
| Density | 1.5g/cm3 |
|---|
| Boiling Point | 379.1ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9NO3S2 |
|---|
| Molecular Weight | 243.30300 |
|---|
| Flash Point | 183.1ºC |
|---|
| Exact Mass | 243.00200 |
|---|
| PSA | 116.65000 |
|---|
| LogP | 3.30220 |
|---|
| Vapour Pressure | 2.74E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.705 |
|---|
| InChIKey | FUIXIBWXXKRUDP-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(O)c(C2SCCS2)c1 |
|---|