Introduction：Basic information about CAS 860036-29-9|N-hydroxy-N-[(1R,2R)-2-[hydroxy(3,3,3-triphenylpropanoyl)amino]cyclohexyl]-3,3,3-tri, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-hydroxy-N-[(1R,2R)-2-[hydroxy(3,3,3-triphenylpropanoyl)amino]cyclohexyl]-3,3,3-triphenylpropanamide |
|---|
| CAS Number | 860036-29-9 | Molecular Weight | 714.890 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 862.1±75.0 °C at 760 mmHg |
|---|
| Molecular Formula | C48H46N2O4 | Melting Point | 237ºC |
|---|
| MSDS | / | Flash Point | 475.2±37.1 °C |
|---|
Names
| Name | N-hydroxy-N-[(1R,2R)-2-[hydroxy(3,3,3-triphenylpropanoyl)amino]cyclohexyl]-3,3,3-triphenylpropanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 862.1±75.0 °C at 760 mmHg |
|---|
| Melting Point | 237ºC |
|---|
| Molecular Formula | C48H46N2O4 |
|---|
| Molecular Weight | 714.890 |
|---|
| Flash Point | 475.2±37.1 °C |
|---|
| Exact Mass | 714.345764 |
|---|
| PSA | 81.08000 |
|---|
| LogP | 10.54 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.689 |
|---|
| InChIKey | VWHFLRGVWVBFFY-NDOUMJCMSA-N |
|---|
| SMILES | O=C(CC(c1ccccc1)(c1ccccc1)c1ccccc1)N(O)C1CCCCC1N(O)C(=O)CC(c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| N,N'-(1R,2R)-1,2-Cyclohexanediylbis(N-hydroxy-3,3,3-triphenylpropanamide) |
| N,N'-(1R,2R)-Cyclohexane-1,2-diylbis(N-hydroxy-3,3,3-triphenylpropanamide) |
| d3719 |
| Benzenepropanamide, N,N'-(1R,2R)-1,2-cyclohexanediylbis[N'-hydroxy-β,β-diphenyl- |
