Introduction:Basic information about CAS 538-64-7|2-Butenedioic acid(2E)-, 1,4-bis(phenylmethyl) ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Butenedioic acid(2E)-, 1,4-bis(phenylmethyl) ester |
|---|
| CAS Number | 538-64-7 | Molecular Weight | 296.31700 |
|---|
| Density | 1.187g/cm3 | Boiling Point | 420.8ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 209.1ºC |
|---|
Names
| Name | 4-oxo-4-phenylmethoxybut-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.187g/cm3 |
|---|
| Boiling Point | 420.8ºC at 760mmHg |
|---|
| Molecular Formula | C18H16O4 |
|---|
| Molecular Weight | 296.31700 |
|---|
| Flash Point | 209.1ºC |
|---|
| Exact Mass | 296.10500 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 3.02940 |
|---|
| Index of Refraction | 1.574 |
|---|
| InChIKey | CPZVJYPXOWWFSW-VAWYXSNFSA-N |
|---|
| SMILES | O=C(C=CC(=O)OCc1ccccc1)OCc1ccccc1 |
|---|
Safety Information
Customs
| HS Code | 2917190090 |
|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| dibenzyl maleate |
| Fumarsaeure-dibenzylester |
| Benzylfumarate |
| 4-oxidanylidene-4-phenylmethoxy-but-2-enoate |
| 4-oxo-4-phenylmethoxy-2-butenoate |
| Dibenzyl fumarate |
| Dibenzylfumarat |