Introduction：Basic information about CAS 20416-04-0|2,3,4,5-Furantetracarboxylicacid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4,5-Furantetracarboxylicacid |
|---|
| CAS Number | 20416-04-0 | Molecular Weight | 244.11200 |
|---|
| Density | 1.995g/cm3 | Boiling Point | 605.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H4O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 320.1ºC |
|---|
Names
| Name | furan-2,3,4,5-tetracarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.995g/cm3 |
|---|
| Boiling Point | 605.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H4O9 |
|---|
| Molecular Weight | 244.11200 |
|---|
| Flash Point | 320.1ºC |
|---|
| Exact Mass | 243.98600 |
|---|
| PSA | 162.34000 |
|---|
| LogP | 0.07240 |
|---|
| Vapour Pressure | 1.61E-15mmHg at 25°C |
|---|
| Index of Refraction | 1.68 |
|---|
| InChIKey | IREPGQRTQFRMQR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1oc(C(=O)O)c(C(=O)O)c1C(=O)O |
|---|
Synonyms
| Furan-tetracarbonsaeure |
| 2,3,4,5-Furantetracarboxylic acid |
| furantetracarboxylic acid |
| Tetracarboxyfuran |
| Furan-2,3,4,5-tetracarbonsaeure |
