Introduction：Basic information about CAS 1934-92-5|Benzamide,N-methyl-N-phenyl-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,N-methyl-N-phenyl- |
|---|
| CAS Number | 1934-92-5 | Molecular Weight | 211.25900 |
|---|
| Density | 1.13g/cm3 | Boiling Point | 341.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H13NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 154.4ºC |
|---|
Names
| Name | N-methyl-N-phenylbenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.13g/cm3 |
|---|
| Boiling Point | 341.3ºC at 760mmHg |
|---|
| Molecular Formula | C14H13NO |
|---|
| Molecular Weight | 211.25900 |
|---|
| Flash Point | 154.4ºC |
|---|
| Exact Mass | 211.10000 |
|---|
| PSA | 20.31000 |
|---|
| LogP | 2.96320 |
|---|
| Vapour Pressure | 8.12E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | LCOPCEDFGGUYRD-UHFFFAOYSA-N |
|---|
| SMILES | CN(C(=O)c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Benzamide,N-methyl-N-phenyl |
| N-methylphenyl benzamide |
| N-phenyl-N-methylbenzamide |
| Benzanilide,N-methyl |
| N-methylphenyl-N-benzamide |
| N-METHYLBENZANILIDE |
| N-methyl-N-phenyl-benzamide |
| N-Benzoyl-N-methylaniline |
