Introduction：Basic information about CAS 14617-06-2|Benzenebutanoic acid,2,4-dimethoxy-g-oxo-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenebutanoic acid,2,4-dimethoxy-g-oxo- |
|---|
| CAS Number | 14617-06-2 | Molecular Weight | 238.23700 |
|---|
| Density | 1.211g/cm3 | Boiling Point | 452.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H14O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 176.1ºC |
|---|
Names
| Name | 4-(2,4-dimethoxyphenyl)-4-oxobutanoic acid |
|---|
Chemical & Physical Properties
| Density | 1.211g/cm3 |
|---|
| Boiling Point | 452.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H14O5 |
|---|
| Molecular Weight | 238.23700 |
|---|
| Flash Point | 176.1ºC |
|---|
| Exact Mass | 238.08400 |
|---|
| PSA | 72.83000 |
|---|
| LogP | 1.75130 |
|---|
| Vapour Pressure | 5.7E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | NRTGCJCRCNCNNC-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)CCC(=O)O)c(OC)c1 |
|---|
