Introduction:Basic information about CAS 3853-88-1|cis,endo-5-Norbornene-2,3-dicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | cis,endo-5-Norbornene-2,3-dicarboxylic acid |
|---|
| CAS Number | 3853-88-1 | Molecular Weight | 182.173 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 419.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H10O4 | Melting Point | 175ºC (dec.)(lit.) |
|---|
| MSDS | / | Flash Point | 221.8±25.2 °C |
|---|
Names
| Name | cis-5-Norbornene-endo-2,3-dicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 419.8±45.0 °C at 760 mmHg |
|---|
| Melting Point | 175ºC (dec.)(lit.) |
|---|
| Molecular Formula | C9H10O4 |
|---|
| Molecular Weight | 182.173 |
|---|
| Flash Point | 221.8±25.2 °C |
|---|
| Exact Mass | 182.057907 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 0.35 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | NIDNOXCRFUCAKQ-DPTVFECHSA-N |
|---|
| SMILES | O=C(O)C1C2C=CC(C2)C1C(=O)O |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | 20/21/22-36/37/38 |
|---|
| Safety Phrases | 26-37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2917209090 |
|---|
Customs
| HS Code | 2917209090 |
|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|---|
Synonyms
| cis,endo-Bicyclo[2.2.1]-5-heptene-2,3-dicarboxylic acid |
| cis,endo-5-Norbornene-2,3-dicarboxylic acid |
| EINECS 223-301-0 |
| MFCD00003735 |
| Bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| 3,6-Endomethylene-.δ.4-tetrahydrophthalic acid |