Introduction：Basic information about CAS 40276-11-7|1,4-Dimethoxy-2-(2-nitroethenyl) benzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Dimethoxy-2-(2-nitroethenyl) benzene |
|---|
| CAS Number | 40276-11-7 | Molecular Weight | 209.199 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 350.8±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H11NO4 | Melting Point | 116-120ºC(lit.) |
|---|
| MSDS | / | Flash Point | 163.2±25.7 °C |
|---|
Names
| Name | 2,5-Dimethoxy-β-nitrostyrene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 350.8±27.0 °C at 760 mmHg |
|---|
| Melting Point | 116-120ºC(lit.) |
|---|
| Molecular Formula | C10H11NO4 |
|---|
| Molecular Weight | 209.199 |
|---|
| Flash Point | 163.2±25.7 °C |
|---|
| Exact Mass | 209.068802 |
|---|
| PSA | 64.28000 |
|---|
| LogP | 2.17 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | IRRZIWHEPWPPJF-AATRIKPKSA-N |
|---|
| SMILES | COc1ccc(OC)c(C=C[N+](=O)[O-])c1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Safety Phrases | 22-24/25 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1,4-Dimethoxy-2-[(E)-2-nitrovinyl]benzene |
| 1,4-Dimethoxy-2-[(E)-2-nitroethenyl]benzene |
| 1,4-Dimethoxy-2-(2-nitroethenyl) benzene |
| Benzene, 1,4-dimethoxy-2-[(E)-2-nitroethenyl]- |
| 2,5-DIMETHOXY-BETA-NITROSTYRENE |
| MFCD00065072 |
