Introduction：Basic information about CAS 57076-84-3|2-Propen-1-one,1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Propen-1-one,1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)- |
|---|
| CAS Number | 57076-84-3 | Molecular Weight | 311.59000 |
|---|
| Density | 1.38g/cm3 | Boiling Point | 448.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H9Cl3O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189ºC |
|---|
Names
| Name | (E)-1-(4-chlorophenyl)-3-(2,4-dichlorophenyl)prop-2-en-1-one |
|---|
Chemical & Physical Properties
| Density | 1.38g/cm3 |
|---|
| Boiling Point | 448.5ºC at 760mmHg |
|---|
| Molecular Formula | C15H9Cl3O |
|---|
| Molecular Weight | 311.59000 |
|---|
| Flash Point | 189ºC |
|---|
| Exact Mass | 309.97200 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 5.54290 |
|---|
| Index of Refraction | 1.644 |
|---|
| InChIKey | GSQGUMFXFLWUJU-XBXARRHUSA-N |
|---|
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
|---|
