Introduction:Basic information about CAS 67237-63-2|N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide |
|---|
| CAS Number | 67237-63-2 | Molecular Weight | 329.39000 |
|---|
| Density | 1.12g/cm3 | Boiling Point | 541.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H23NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 281.2ºC |
|---|
Names
| Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-methoxyphenyl)acetamide |
|---|
Chemical & Physical Properties
| Density | 1.12g/cm3 |
|---|
| Boiling Point | 541.3ºC at 760 mmHg |
|---|
| Molecular Formula | C19H23NO4 |
|---|
| Molecular Weight | 329.39000 |
|---|
| Flash Point | 281.2ºC |
|---|
| Exact Mass | 329.16300 |
|---|
| PSA | 56.79000 |
|---|
| LogP | 3.00470 |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | JXUNQKVJRZBSER-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(CC(=O)NCCc2ccc(OC)c(OC)c2)c1 |
|---|