Introduction:Basic information about CAS 595-52-8|Pregna-1,4-diene-3,20-dione, 9-fluoro-11.beta., 16.alpha.,17-trihydroxy-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pregna-1,4-diene-3,20-dione, 9-fluoro-11.beta., 16.alpha.,17-trihydroxy- |
|---|
| CAS Number | 595-52-8 | Molecular Weight | 378.43400 |
|---|
| Density | 1.35g/cm3 | Boiling Point | 544.5ºC at 760 mmHg |
|---|
| Molecular Formula | C21H27FO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.1ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Boiling Point | 544.5ºC at 760 mmHg |
|---|
| Molecular Formula | C21H27FO5 |
|---|
| Molecular Weight | 378.43400 |
|---|
| Flash Point | 283.1ºC |
|---|
| Exact Mass | 378.18400 |
|---|
| PSA | 94.83000 |
|---|
| LogP | 1.64810 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | DYCBAFABWCTLEN-PMVIMZBYSA-N |
|---|
| SMILES | CC(=O)C1(O)C(O)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
|---|