Introduction:Basic information about CAS 842967-58-2|[(2,5-Dimethyl-furan-3-carbonyl)-amino]-acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [(2,5-Dimethyl-furan-3-carbonyl)-amino]-acetic acid |
|---|
| CAS Number | 842967-58-2 | Molecular Weight | 197.18800 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H11NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [(2,5-Dimethyl-furan-3-carbonyl)-amino]-acetic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H11NO4 |
|---|
| Molecular Weight | 197.18800 |
|---|
| Exact Mass | 197.06900 |
|---|
| PSA | 79.54000 |
|---|
| LogP | 1.10170 |
|---|
| InChIKey | NBPIKJMMYBAHGS-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C(=O)NCC(=O)O)c(C)o1 |
|---|
Safety Information
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|