Introduction:Basic information about CAS 193693-68-4|Fmoc-Nip-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-Nip-OH |
|---|
| CAS Number | 193693-68-4 | Molecular Weight | 351.39600 |
|---|
| Density | 1.293g/cm3 | Boiling Point | 561.6ºC at 760mmHg |
|---|
| Molecular Formula | C21H21NO4 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 293.5ºC |
|---|
Names
| Name | (3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.293g/cm3 |
|---|
| Boiling Point | 561.6ºC at 760mmHg |
|---|
| Molecular Formula | C21H21NO4 |
|---|
| Molecular Weight | 351.39600 |
|---|
| Flash Point | 293.5ºC |
|---|
| Exact Mass | 351.14700 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 3.67000 |
|---|
| Vapour Pressure | 1.89E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | FINXGQXNIBNREL-AWEZNQCLSA-N |
|---|
| SMILES | O=C(O)C1CCCN(C(=O)OCC2c3ccccc3-c3ccccc32)C1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| (S)-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}piperidine-3-carboxylic acid |
| (s)-piperidine-1,3-dicarboxylic acid 1-(9h-fluoren-9-ylmethyl) ester |
| 1-n-fmoc-piperidine-3(s)-carboxylic acid |
| (s)-fmoc-piperidine-3-carboxylic acid |
| L-1-Fmoc-Nipecotic acid |
| N-Fmoc-(S)-nipecotic acid |
| fmoc-(s)-nipecotic acid |
| (s)-fmoc-nip |
| (s)-1-fmoc-piperidine-3-carboxylic acid |
| fmoc-(s)-nip |
| Fmoc-Nip-OH |