Introduction:Basic information about CAS 158922-07-7|Fmoc- DL -Nip-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc- DL -Nip-OH |
|---|
| CAS Number | 158922-07-7 | Molecular Weight | 351.39600 |
|---|
| Density | 1.293g/cm3 | Boiling Point | 561.6ºC at 760 mmHg |
|---|
| Molecular Formula | C21H21NO4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 293.5ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 1-(9H-fluoren-9-ylmethoxycarbonyl)piperidine-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.293g/cm3 |
|---|
| Boiling Point | 561.6ºC at 760 mmHg |
|---|
| Molecular Formula | C21H21NO4 |
|---|
| Molecular Weight | 351.39600 |
|---|
| Flash Point | 293.5ºC |
|---|
| Exact Mass | 351.14700 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 3.67000 |
|---|
| Vapour Pressure | 1.89E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.62 |
|---|
| InChIKey | FINXGQXNIBNREL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1CCCN(C(=O)OCC2c3ccccc3-c3ccccc32)C1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Fmoc-DL-Nip-OH |
| Fmoc-nipecotic acid |
| (R)-1-Fmoc-piperidine-3-carboxylicacid |
| AmbotzFAA1501 |
| MFCD00673789 |
| 9H-fluoren-9-ylmethyl 3-carboxypiperidine-1-carboxylate |
| 1-(((9H-Fluoren-9-yl)methoxy)carbonyl)piperidine-3-carboxylic acid |
| N-Fmoc-nipecotic acid |
| (R,S)-Fmoc-nipecotic acid |
| Fmoc-DL-nipecotic acid |
| Fmoc-3-carboxypiperidine |
| N-Fmoc-piperidine-3-carboxylic acid |
| Fmoc-Nip-OH |