Introduction:Basic information about CAS 159991-23-8|(R)-3-(tert-Butoxycarbonylamino)butanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-3-(tert-Butoxycarbonylamino)butanoic acid |
|---|
| CAS Number | 159991-23-8 | Molecular Weight | 203.236 |
|---|
| Density | 1.101±0.06 g/cm3 | Boiling Point | 339.5±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H17NO4 | Melting Point | 104-107 ºC |
|---|
| MSDS | USA | Flash Point | 159.1±23.2 °C |
|---|
Names
| Name | (R)-3-((tert-Butoxycarbonyl)amino)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.101±0.06 g/cm3 |
|---|
| Boiling Point | 339.5±25.0 °C at 760 mmHg |
|---|
| Melting Point | 104-107 ºC |
|---|
| Molecular Formula | C9H17NO4 |
|---|
| Molecular Weight | 203.236 |
|---|
| Flash Point | 159.1±23.2 °C |
|---|
| Exact Mass | 203.115753 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 1.27 |
|---|
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.461 |
|---|
| InChIKey | PYNDHEONPQYIAN-ZCFIWIBFSA-N |
|---|
| SMILES | CC(CC(=O)O)NC(=O)OC(C)(C)C |
|---|
| Storage condition | Store at 0-5°C |
|---|
| Water Solubility | Sparingly soluble (10 g/L) (25 ºC) |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | 25 |
|---|
| Safety Phrases | 45 |
|---|
| HS Code | 2924199090 |
|---|
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| AmbotzBAA6090 |
| Butanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, (3R)- |
| Butanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, (3S)- |
| (3S)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid |
| (r)-boc-b2-homoalanine |
| MFCD00270343 |
| (r)-boc-b2-hoala-oh |
| (3S)-3-[(tert-Butoxycarbonyl)amino]butanoic acid |
| (R)-3-(tert-Butoxycarbonylamino)butanoic acid |
| (r)-n-boc-3-aminobutyric acid |
| boc-d-ala-(c*ch2)oh |
| (R)-3-(Boc-amino)butyric acid |
| (3R)-3-[(tert-Butoxycarbonyl)amino]butanoic acid |
| (3R)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)butanoic acid |
| 3-(Boc-amino)butanoic Acid |
| boc-d-3-aminobutyric acid |
| Boc-D-β-homoalanine |