Introduction:Basic information about CAS 871798-94-6|5,6-DI(FURAN-2-YL)-3-PROPYL-[2,2']BIPYRIDINYL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5,6-DI(FURAN-2-YL)-3-PROPYL-[2,2']BIPYRIDINYL |
|---|
| CAS Number | 871798-94-6 | Molecular Weight | 330.38000 |
|---|
| Density | 1.152g/cm3 | Boiling Point | 439.5ºC at 760 mmHg |
|---|
| Molecular Formula | C21H18N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 111.1ºC |
|---|
Names
| Name | 2,3-bis(furan-2-yl)-5-propyl-6-pyridin-2-ylpyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.152g/cm3 |
|---|
| Boiling Point | 439.5ºC at 760 mmHg |
|---|
| Molecular Formula | C21H18N2O2 |
|---|
| Molecular Weight | 330.38000 |
|---|
| Flash Point | 111.1ºC |
|---|
| Exact Mass | 330.13700 |
|---|
| PSA | 52.06000 |
|---|
| LogP | 5.61610 |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | JNFPJQQZIPLARP-UHFFFAOYSA-N |
|---|
| SMILES | CCCc1cc(-c2ccco2)c(-c2ccco2)nc1-c1ccccn1 |
|---|
Synonyms
| 5,6-DI(FURAN-2-YL)-3-PROPYL-[2,2A'A inverted exclamation markA'A ]BIPYRIDINYL |
| 5,6-Di(furan-2-yl)-3-propyl-[2,2']bipyridinyl |
| 2,2'-Bipyridine,5,6-di-2-furanyl-3-propyl |