Introduction:Basic information about CAS 572923-25-2|(S)-3-TERT-BUTYL-BETA-ALANINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-3-TERT-BUTYL-BETA-ALANINE |
|---|
| CAS Number | 572923-25-2 | Molecular Weight | 241.28500 |
|---|
| Density | 1.23g/cm3 | Boiling Point | 439.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 219.8ºC |
|---|
Names
| Name | 4-{[(1S)-2-Hydroxy-1-phenylethyl]amino}benzaldehyde |
|---|
Chemical & Physical Properties
| Density | 1.23g/cm3 |
|---|
| Boiling Point | 439.8ºC at 760 mmHg |
|---|
| Molecular Formula | C15H15NO2 |
|---|
| Molecular Weight | 241.28500 |
|---|
| Flash Point | 219.8ºC |
|---|
| Exact Mass | 241.11000 |
|---|
| PSA | 49.33000 |
|---|
| LogP | 2.71760 |
|---|
| Index of Refraction | 1.67 |
|---|
| InChIKey | HFEJSHLFXWQQTL-OAHLLOKOSA-N |
|---|
| SMILES | O=Cc1ccc(NC(CO)c2ccccc2)cc1 |
|---|