Introduction:Basic information about CAS 193740-76-0|Fluoxastrobin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fluoxastrobin |
|---|
| CAS Number | 193740-76-0 | Molecular Weight | 458.82700 |
|---|
| Density | 1.43g/cm3 | Boiling Point | 497.3ºC at 760mmHg |
|---|
| Molecular Formula | C21H16ClFN4O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.6ºC |
|---|
Names
| Name | (E)-1-(2-{[6-(2-Chlorophenoxy)-5-fluoro-4-pyrimidinyl]oxy}phenyl) -1-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-methoxymethanimine |
|---|
Chemical & Physical Properties
| Density | 1.43g/cm3 |
|---|
| Boiling Point | 497.3ºC at 760mmHg |
|---|
| Molecular Formula | C21H16ClFN4O5 |
|---|
| Molecular Weight | 458.82700 |
|---|
| Flash Point | 254.6ºC |
|---|
| Exact Mass | 458.07900 |
|---|
| PSA | 96.65000 |
|---|
| LogP | 4.00010 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | UFEODZBUAFNAEU-UHFFFAOYSA-N |
|---|
| SMILES | CON=C(C1=NOCCO1)c1ccccc1Oc1ncnc(Oc2ccccc2Cl)c1F |
|---|