Introduction：Basic information about CAS 51632-33-8|2-(4-Fluorophenyl)-3-methylbutyricacid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Fluorophenyl)-3-methylbutyricacid |
|---|
| CAS Number | 51632-33-8 | Molecular Weight | 196.218 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 283.9±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H13FO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 125.5±20.4 °C |
|---|
Names
| Name | 2-(4-Fluorophenyl)-3-methylbutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 283.9±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H13FO2 |
|---|
| Molecular Weight | 196.218 |
|---|
| Flash Point | 125.5±20.4 °C |
|---|
| Exact Mass | 196.089951 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 2.78 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.508 |
|---|
| InChIKey | YBQLHBYGMUXCEW-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(C(=O)O)c1ccc(F)cc1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-Fluoro-alpha-(1-Methylethyl)-Benzeneacetic Acid |
| 2-(4'-fluorophenyl)-3-methylbutyric acid |
| Benzeneacetic acid, 4-fluoro-α-(1-methylethyl)- |
| 4-FLUORO-4-DEOXY-D-GLUCOSE |
| 4-Deoxy-4-fluoroglucose |
| (+/-)-2-(4-fluorophenyl)-3-methylbutanoic acid |
| D-Glucose,4-deoxy-4-fluoro |
| 2-(4-Fluorophenyl)-3-methylbutanoic acid |
| 2-(p-fluorophenyl)-3-methylbutyric acid |
