Introduction：Basic information about CAS 159125-41-4|N-[4-(4-Acetamido-4-phenyl-1-piperidinyl)-2-(3,4-dichlorophenyl)b utyl]-N-methylbenz, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[4-(4-Acetamido-4-phenyl-1-piperidinyl)-2-(3,4-dichlorophenyl)b utyl]-N-methylbenzamide |
|---|
| CAS Number | 159125-41-4 | Molecular Weight | 552.53400 |
|---|
| Density | 1.26 | Boiling Point | 734.669ºC at 760 mmHg |
|---|
| Molecular Formula | C31H35Cl2N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 398.114ºC |
|---|
Names
| Name | N-[4-(4-Acetamido-4-phenyl-1-piperidinyl)-2-(3,4-dichlorophenyl)b utyl]-N-methylbenzamide |
|---|
Chemical & Physical Properties
| Density | 1.26 |
|---|
| Boiling Point | 734.669ºC at 760 mmHg |
|---|
| Molecular Formula | C31H35Cl2N3O2 |
|---|
| Molecular Weight | 552.53400 |
|---|
| Flash Point | 398.114ºC |
|---|
| Exact Mass | 551.21100 |
|---|
| PSA | 56.14000 |
|---|
| LogP | 7.14490 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | PGKXDIMONUAMFR-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)NC1(c2ccccc2)CCN(CCC(CN(C)C(=O)c2ccccc2)c2ccc(Cl)c(Cl)c2)CC1 |
|---|
