Introduction:Basic information about CAS 153381-37-4|Acetamido(4-fluorophenyl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Acetamido(4-fluorophenyl)acetic acid |
|---|
| CAS Number | 153381-37-4 | Molecular Weight | 211.19000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H10FNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Acetamido(4-fluorophenyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H10FNO3 |
|---|
| Molecular Weight | 211.19000 |
|---|
| Exact Mass | 211.06400 |
|---|
| PSA | 69.89000 |
|---|
| LogP | 1.92780 |
|---|
| InChIKey | HZTADRWBVNKKSJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)NC(C(=O)O)c1ccc(F)cc1 |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 11-Hydroxy-9,10-dihydro-9,10-ethanoanthracene |
| tetracyclo[6.6.2.0^{2,7}.0^{9,14}]hexadeca-2(7),3,5,9(14),10,12-hexaen-15-ol |
| 9,10-dihydro-9,10-ethanoanthracen-11-ol |
| 9,10-Dihydro-11-hydroxy-9,10-ethanoanthracene |
| N-acetyl-4-fluorophenylglycine |
| 9,10-dihydro-9,10-ethanoantracen-11-ol |
| (2RS)-5,6:7,8-dibenzobicyclo[2.2.2]-octan-2-ol |