Introduction：Basic information about CAS 214470-35-6|6-Nitro-4-oxo-1,4-dihydro-3-quinolinecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Nitro-4-oxo-1,4-dihydro-3-quinolinecarbonitrile |
|---|
| CAS Number | 214470-35-6 | Molecular Weight | 215.16500 |
|---|
| Density | 1.534g/cm3 | Boiling Point | 394.683ºC at 760 mmHg |
|---|
| Molecular Formula | C10H5N3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-Nitro-4-oxo-1,4-dihydro-3-quinolinecarbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.534g/cm3 |
|---|
| Boiling Point | 394.683ºC at 760 mmHg |
|---|
| Molecular Formula | C10H5N3O3 |
|---|
| Molecular Weight | 215.16500 |
|---|
| Exact Mass | 215.03300 |
|---|
| PSA | 102.47000 |
|---|
| LogP | 1.83118 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.674 |
|---|
| InChIKey | PZIXIFBGEDRCAM-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1c[nH]c2ccc([N+](=O)[O-])cc2c1=O |
|---|
Synonyms
| 4-methyl-6-nitro-coumarin |
| 1,4-dihydroquinoline-6-nitro-4-oxo-3-carbonitrile |
| 6-nitro-4-oxo-1,4-dihydro-quinoline-3-carbonitrile |
| 2H-1-Benzopyran-2-one,4-methyl-6-nitro |
| 6-nitro-4-methylchromen-2-one |
| 4-methyl-6-nitro-chromen-2-one |
| 6-nitro-4-methylcoumarin |
| 4-Methyl-6-nitro-cumarin |
